C22H19N5O7 — CID 6357979
2-[(1S,3R,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide (PubChem CID 6357979) has the molecular formula C22H19N5O7 and a molecular weight of 465.42 g/mol. Its IUPAC name is 2-[(1S,3R,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide.
| Compound Name | 2-[(1S,3R,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide |
|---|---|
| PubChem CID | 6357979 |
| Molecular Formula | C22H19N5O7 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-[(1S,3R,3aR,6aR)-5-(2-methoxy-5-nitrophenyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)[C@H]2[C@H](CC(N)=O)N[C@]3(C(=O)Nc4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C22H19N5O7/c1-34-15-7-6-10(27(32)33)8-14(15)26-19(29)17-13(9-16(23)28)25-22(18(17)20(26)30)11-4-2-3-5-12(11)24-21(22)31/h2-8,13,17-18,25H,9H2,1H3,(H2,23,28)(H,24,31)/t13-,17-,18-,22-/m0/s1 |
| InChIKey | ABXKHLXFUDCSFK-GJDLODDASA-N |
| XLogP | 0.40 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|