C17H21N3O4 — CID 98383216
(1S,3R,6S,7R)-6,7-dimethyl-N'-(4-nitrophenyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carbohydrazide (PubChem CID 98383216) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is (1S,3R,6S,7R)-6,7-dimethyl-N'-(4-nitrophenyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carbohydrazide.
| Compound Name | (1S,3R,6S,7R)-6,7-dimethyl-N'-(4-nitrophenyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carbohydrazide |
|---|---|
| PubChem CID | 98383216 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (1S,3R,6S,7R)-6,7-dimethyl-N'-(4-nitrophenyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carbohydrazide |
| SMILES | C[C@]12CC[C@H]3C[C@@]1(C(=O)NNc1ccc([N+](=O)[O-])cc1)OC[C@@]32C |
| InChI | InChI=1S/C17H21N3O4/c1-15-10-24-17(9-11(15)7-8-16(15,17)2)14(21)19-18-12-3-5-13(6-4-12)20(22)23/h3-6,11,18H,7-10H2,1-2H3,(H,19,21)/t11-,15-,16+,17-/m0/s1 |
| InChIKey | JXPWGQRXSSSLGE-UQCMEYCASA-N |
| XLogP | 2.63 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|