C17H23NO4S — CID 98385098
2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide (PubChem CID 98385098) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 98385098 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)C[C@H]2C[C@@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C17H23NO4S/c1-2-23(21,22)14-5-6-16(19)15(10-14)18-17(20)9-13-8-11-3-4-12(13)7-11/h5-6,10-13,19H,2-4,7-9H2,1H3,(H,18,20)/t11-,12-,13-/m1/s1 |
| InChIKey | UPKDMZWFBMDMQI-JHJVBQTASA-N |
| XLogP | 2.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|