C31H39F3N2O5 — CID 98417695
(3aR,5R,7S,7aS)-2,2-dimethyl-7-phenylmethoxy-N-(2-pyrrolidin-1-ylethyl)-5-[[3-(trifluoromethyl)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 98417695) has the molecular formula C31H39F3N2O5 and a molecular weight of 576.66 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-2,2-dimethyl-7-phenylmethoxy-N-(2-pyrrolidin-1-ylethyl)-5-[[3-(trifluoromethyl)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-2,2-dimethyl-7-phenylmethoxy-N-(2-pyrrolidin-1-ylethyl)-5-[[3-(trifluoromethyl)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98417695 |
| Molecular Formula | C31H39F3N2O5 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | (3aR,5R,7S,7aS)-2,2-dimethyl-7-phenylmethoxy-N-(2-pyrrolidin-1-ylethyl)-5-[[3-(trifluoromethyl)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1(C)O[C@H]2[C@@H](OCc3ccccc3)C[C@](OCc3cccc(C(F)(F)F)c3)(C(=O)NCCN3CCCC3)C[C@H]2O1 |
| InChI | InChI=1S/C31H39F3N2O5/c1-29(2)40-26-19-30(28(37)35-13-16-36-14-6-7-15-36,39-21-23-11-8-12-24(17-23)31(32,33)34)18-25(27(26)41-29)38-20-22-9-4-3-5-10-22/h3-5,8-12,17,25-27H,6-7,13-16,18-21H2,1-2H3,(H,35,37)/t25-,26+,27-,30+/m0/s1 |
| InChIKey | WYGJDEYUHXVZBL-DEJVGURISA-N |
| XLogP | 5.07 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |