C27H32F3NO6 — CID 42811884
(3aR,5R,7aS)-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 42811884) has the molecular formula C27H32F3NO6 and a molecular weight of 523.55 g/mol. Its IUPAC name is (3aR,5R,7aS)-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7aS)-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42811884 |
| Molecular Formula | C27H32F3NO6 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (3aR,5R,7aS)-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CNC(=O)[C@@]1(OCc2cccc(C)c2)CC(OCc2cccc(OC(F)(F)F)c2)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C27H32F3NO6/c1-17-7-5-8-18(11-17)16-34-26(24(32)31-4)13-21(23-22(14-26)36-25(2,3)37-23)33-15-19-9-6-10-20(12-19)35-27(28,29)30/h5-12,21-23H,13-16H2,1-4H3,(H,31,32)/t21?,22-,23+,26-/m1/s1 |
| InChIKey | PRUVLPUBISZVME-MCDNJBFBSA-N |
| XLogP | 4.79 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |