C22H30FNO5 — CID 11922714
(3aR,5R,7S,7aS)-7-(cyclopropylmethoxy)-5-[(4-fluorophenyl)methoxy]-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 11922714) has the molecular formula C22H30FNO5 and a molecular weight of 407.48 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-7-(cyclopropylmethoxy)-5-[(4-fluorophenyl)methoxy]-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-7-(cyclopropylmethoxy)-5-[(4-fluorophenyl)methoxy]-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 11922714 |
| Molecular Formula | C22H30FNO5 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (3aR,5R,7S,7aS)-7-(cyclopropylmethoxy)-5-[(4-fluorophenyl)methoxy]-N,2,2-trimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CNC(=O)[C@@]1(OCc2ccc(F)cc2)C[C@H](OCC2CC2)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C22H30FNO5/c1-21(2)28-18-11-22(20(25)24-3,27-13-15-6-8-16(23)9-7-15)10-17(19(18)29-21)26-12-14-4-5-14/h6-9,14,17-19H,4-5,10-13H2,1-3H3,(H,24,25)/t17-,18+,19-,22+/m0/s1 |
| InChIKey | GGGMYXMIWPUFQE-LMVRJCEZSA-N |
| XLogP | 2.94 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |