C29H32F2N2O5 — CID 42811960
(3aR,5R,7aS)-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-7-[(2,6-difluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 42811960) has the molecular formula C29H32F2N2O5 and a molecular weight of 526.58 g/mol. Its IUPAC name is (3aR,5R,7aS)-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-7-[(2,6-difluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7aS)-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-7-[(2,6-difluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42811960 |
| Molecular Formula | C29H32F2N2O5 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (3aR,5R,7aS)-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-7-[(2,6-difluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1(C)O[C@@H]2C[C@@](OCc3ccc(C#N)cc3)(C(=O)NCC3CC3)CC(OCc3c(F)cccc3F)[C@@H]2O1 |
| InChI | InChI=1S/C29H32F2N2O5/c1-28(2)37-25-13-29(27(34)33-15-19-8-9-19,36-16-20-10-6-18(14-32)7-11-20)12-24(26(25)38-28)35-17-21-22(30)4-3-5-23(21)31/h3-7,10-11,19,24-26H,8-9,12-13,15-17H2,1-2H3,(H,33,34)/t24?,25-,26+,29-/m1/s1 |
| InChIKey | NXBLEVMONHVAGO-CIIYXKIESA-N |
| XLogP | 4.52 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |