C29H33ClN2O5 — CID 42811959
(3aR,5R,7aS)-7-[(3-chlorophenyl)methoxy]-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 42811959) has the molecular formula C29H33ClN2O5 and a molecular weight of 525.05 g/mol. Its IUPAC name is (3aR,5R,7aS)-7-[(3-chlorophenyl)methoxy]-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7aS)-7-[(3-chlorophenyl)methoxy]-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42811959 |
| Molecular Formula | C29H33ClN2O5 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (3aR,5R,7aS)-7-[(3-chlorophenyl)methoxy]-5-[(4-cyanophenyl)methoxy]-N-(cyclopropylmethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1(C)O[C@@H]2C[C@@](OCc3ccc(C#N)cc3)(C(=O)NCC3CC3)CC(OCc3cccc(Cl)c3)[C@@H]2O1 |
| InChI | InChI=1S/C29H33ClN2O5/c1-28(2)36-25-14-29(27(33)32-16-20-8-9-20,35-18-21-10-6-19(15-31)7-11-21)13-24(26(25)37-28)34-17-22-4-3-5-23(30)12-22/h3-7,10-12,20,24-26H,8-9,13-14,16-18H2,1-2H3,(H,32,33)/t24?,25-,26+,29-/m1/s1 |
| InChIKey | PAHMSGJYCFWISL-CIIYXKIESA-N |
| XLogP | 4.89 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |