C28H33FN2O5 — CID 93304511
(3aR,5R,7S,7aS)-7-[(2-cyanophenyl)methoxy]-5-[(3-fluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 93304511) has the molecular formula C28H33FN2O5 and a molecular weight of 496.58 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-7-[(2-cyanophenyl)methoxy]-5-[(3-fluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-7-[(2-cyanophenyl)methoxy]-5-[(3-fluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 93304511 |
| Molecular Formula | C28H33FN2O5 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (3aR,5R,7S,7aS)-7-[(2-cyanophenyl)methoxy]-5-[(3-fluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)NC(=O)[C@@]1(OCc2cccc(F)c2)C[C@H](OCc2ccccc2C#N)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C28H33FN2O5/c1-18(2)31-26(32)28(34-16-19-8-7-11-22(29)12-19)13-23(25-24(14-28)35-27(3,4)36-25)33-17-21-10-6-5-9-20(21)15-30/h5-12,18,23-25H,13-14,16-17H2,1-4H3,(H,31,32)/t23-,24+,25-,28+/m0/s1 |
| InChIKey | QSUMPSNIOMWNSX-HLPJKERBSA-N |
| XLogP | 4.38 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |