C28H31F3N2O6 — CID 98421712
(3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-ethyl-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 98421712) has the molecular formula C28H31F3N2O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-ethyl-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-ethyl-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98421712 |
| Molecular Formula | C28H31F3N2O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-ethyl-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CCNC(=O)[C@@]1(OCc2ccccc2C#N)C[C@H](OCc2cccc(OC(F)(F)F)c2)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C28H31F3N2O6/c1-4-33-25(34)27(36-17-20-10-6-5-9-19(20)15-32)13-22(24-23(14-27)38-26(2,3)39-24)35-16-18-8-7-11-21(12-18)37-28(29,30)31/h5-12,22-24H,4,13-14,16-17H2,1-3H3,(H,33,34)/t22-,23+,24-,27+/m0/s1 |
| InChIKey | MAKUBMKLDBRACQ-AALWMKDKSA-N |
| XLogP | 4.75 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |