C29H36F3NO8 — CID 98368603
(3aR,5R,7S,7aS)-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 98368603) has the molecular formula C29H36F3NO8 and a molecular weight of 583.60 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98368603 |
| Molecular Formula | C29H36F3NO8 |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | (3aR,5R,7S,7aS)-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-7-[[3-(trifluoromethoxy)phenyl]methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | COCCNC(=O)[C@@]1(OCc2cccc(OC)c2)C[C@H](OCc2cccc(OC(F)(F)F)c2)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C29H36F3NO8/c1-27(2)40-24-16-28(26(34)33-11-12-35-3,38-18-20-8-5-9-21(13-20)36-4)15-23(25(24)41-27)37-17-19-7-6-10-22(14-19)39-29(30,31)32/h5-10,13-14,23-25H,11-12,15-18H2,1-4H3,(H,33,34)/t23-,24+,25-,28+/m0/s1 |
| InChIKey | WJBCPMAUJIVDCA-HLPJKERBSA-N |
| XLogP | 4.51 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|