C28H35F2NO7 — CID 98421150
(3aR,5R,7S,7aS)-7-[(2,6-difluorophenyl)methoxy]-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 98421150) has the molecular formula C28H35F2NO7 and a molecular weight of 535.58 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-7-[(2,6-difluorophenyl)methoxy]-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-7-[(2,6-difluorophenyl)methoxy]-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98421150 |
| Molecular Formula | C28H35F2NO7 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (3aR,5R,7S,7aS)-7-[(2,6-difluorophenyl)methoxy]-N-(2-methoxyethyl)-5-[(3-methoxyphenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | COCCNC(=O)[C@@]1(OCc2cccc(OC)c2)C[C@H](OCc2c(F)cccc2F)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C28H35F2NO7/c1-27(2)37-24-15-28(26(32)31-11-12-33-3,36-16-18-7-5-8-19(13-18)34-4)14-23(25(24)38-27)35-17-20-21(29)9-6-10-22(20)30/h5-10,13,23-25H,11-12,14-17H2,1-4H3,(H,31,32)/t23-,24+,25-,28+/m0/s1 |
| InChIKey | MYFMBRGUHZUYHJ-HLPJKERBSA-N |
| XLogP | 3.89 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|