C24H30N2O5 — CID 11922801
(3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-cyclopropyl-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 11922801) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-cyclopropyl-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-cyclopropyl-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 11922801 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (3aR,5R,7S,7aS)-5-[(2-cyanophenyl)methoxy]-N-cyclopropyl-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | C=CCO[C@H]1C[C@](OCc2ccccc2C#N)(C(=O)NC2CC2)C[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C24H30N2O5/c1-4-11-28-19-12-24(22(27)26-18-9-10-18,13-20-21(19)31-23(2,3)30-20)29-15-17-8-6-5-7-16(17)14-25/h4-8,18-21H,1,9-13,15H2,2-3H3,(H,26,27)/t19-,20+,21-,24+/m0/s1 |
| InChIKey | HEJUDIFPALNXIU-SEDAZVQISA-N |
| XLogP | 2.98 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|