C27H31ClFNO5 — CID 93304053
(3aR,5R,7R,7aS)-7-[(3-chlorophenyl)methoxy]-N-cyclopropyl-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 93304053) has the molecular formula C27H31ClFNO5 and a molecular weight of 504.00 g/mol. Its IUPAC name is (3aR,5R,7R,7aS)-7-[(3-chlorophenyl)methoxy]-N-cyclopropyl-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7R,7aS)-7-[(3-chlorophenyl)methoxy]-N-cyclopropyl-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 93304053 |
| Molecular Formula | C27H31ClFNO5 |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (3aR,5R,7R,7aS)-7-[(3-chlorophenyl)methoxy]-N-cyclopropyl-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1(C)O[C@H]2[C@H](OCc3cccc(Cl)c3)C[C@](OCc3ccccc3F)(C(=O)NC3CC3)C[C@H]2O1 |
| InChI | InChI=1S/C27H31ClFNO5/c1-26(2)34-23-14-27(25(31)30-20-10-11-20,33-16-18-7-3-4-9-21(18)29)13-22(24(23)35-26)32-15-17-6-5-8-19(28)12-17/h3-9,12,20,22-24H,10-11,13-16H2,1-2H3,(H,30,31)/t22-,23-,24+,27-/m1/s1 |
| InChIKey | WIIUOWLHGHHKHB-CHQSNSNVSA-N |
| XLogP | 4.91 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.00 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |