C26H31F2NO5 — CID 42811883
(3aR,5R,7aS)-7-[(2,3-difluorophenyl)methoxy]-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 42811883) has the molecular formula C26H31F2NO5 and a molecular weight of 475.53 g/mol. Its IUPAC name is (3aR,5R,7aS)-7-[(2,3-difluorophenyl)methoxy]-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7aS)-7-[(2,3-difluorophenyl)methoxy]-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42811883 |
| Molecular Formula | C26H31F2NO5 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (3aR,5R,7aS)-7-[(2,3-difluorophenyl)methoxy]-N,2,2-trimethyl-5-[(3-methylphenyl)methoxy]-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CNC(=O)[C@@]1(OCc2cccc(C)c2)CC(OCc2cccc(F)c2F)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C26H31F2NO5/c1-16-7-5-8-17(11-16)14-32-26(24(30)29-4)12-20(23-21(13-26)33-25(2,3)34-23)31-15-18-9-6-10-19(27)22(18)28/h5-11,20-21,23H,12-15H2,1-4H3,(H,29,30)/t20?,21-,23+,26-/m1/s1 |
| InChIKey | SLIGSSQRNRUIQI-SFIZRYLQSA-N |
| XLogP | 4.17 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |