C27H34FNO5 — CID 93304102
(3aR,5R,7S,7aS)-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-7-phenylmethoxy-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 93304102) has the molecular formula C27H34FNO5 and a molecular weight of 471.57 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-7-phenylmethoxy-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7S,7aS)-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-7-phenylmethoxy-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 93304102 |
| Molecular Formula | C27H34FNO5 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (3aR,5R,7S,7aS)-5-[(2-fluorophenyl)methoxy]-2,2-dimethyl-7-phenylmethoxy-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)NC(=O)[C@@]1(OCc2ccccc2F)C[C@H](OCc2ccccc2)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C27H34FNO5/c1-18(2)29-25(30)27(32-17-20-12-8-9-13-21(20)28)14-22(31-16-19-10-6-5-7-11-19)24-23(15-27)33-26(3,4)34-24/h5-13,18,22-24H,14-17H2,1-4H3,(H,29,30)/t22-,23+,24-,27+/m0/s1 |
| InChIKey | QZFPVRPACZNNGG-AALWMKDKSA-N |
| XLogP | 4.51 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |