C27H32ClF2NO5 — CID 42811897
(3aR,5R,7aS)-5-[(3-chlorophenyl)methoxy]-7-[(2,3-difluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide (PubChem CID 42811897) has the molecular formula C27H32ClF2NO5 and a molecular weight of 524.00 g/mol. Its IUPAC name is (3aR,5R,7aS)-5-[(3-chlorophenyl)methoxy]-7-[(2,3-difluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aR,5R,7aS)-5-[(3-chlorophenyl)methoxy]-7-[(2,3-difluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42811897 |
| Molecular Formula | C27H32ClF2NO5 |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | (3aR,5R,7aS)-5-[(3-chlorophenyl)methoxy]-7-[(2,3-difluorophenyl)methoxy]-2,2-dimethyl-N-propan-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)NC(=O)[C@@]1(OCc2cccc(Cl)c2)CC(OCc2cccc(F)c2F)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C27H32ClF2NO5/c1-16(2)31-25(32)27(34-14-17-7-5-9-19(28)11-17)12-21(24-22(13-27)35-26(3,4)36-24)33-15-18-8-6-10-20(29)23(18)30/h5-11,16,21-22,24H,12-15H2,1-4H3,(H,31,32)/t21?,22-,24+,27-/m1/s1 |
| InChIKey | SBNXBYXTNOUOIW-UMJLLIDLSA-N |
| XLogP | 5.30 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |