C17H24N2O2 — CID 98449737
(2R)-2-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile (PubChem CID 98449737) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2R)-2-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile.
| Compound Name | (2R)-2-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 98449737 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2R)-2-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
| SMILES | CC(C)=C[C@@H]1[C@H](C(=O)[C@@H](C#N)C(=O)N2CCCC2)C1(C)C |
| InChI | InChI=1S/C17H24N2O2/c1-11(2)9-13-14(17(13,3)4)15(20)12(10-18)16(21)19-7-5-6-8-19/h9,12-14H,5-8H2,1-4H3/t12-,13-,14-/m1/s1 |
| InChIKey | OABPECDHZCEOCK-MGPQQGTHSA-N |
| XLogP | 2.56 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|