C17H16N2O2S — CID 98450182
(2S)-2-cyano-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxo-N-phenylpropanamide (PubChem CID 98450182) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is (2S)-2-cyano-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxo-N-phenylpropanamide.
| Compound Name | (2S)-2-cyano-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxo-N-phenylpropanamide |
|---|---|
| PubChem CID | 98450182 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (2S)-2-cyano-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxo-N-phenylpropanamide |
| SMILES | CCc1sc(C(=O)[C@H](C#N)C(=O)Nc2ccccc2)cc1C |
| InChI | InChI=1S/C17H16N2O2S/c1-3-14-11(2)9-15(22-14)16(20)13(10-18)17(21)19-12-7-5-4-6-8-12/h4-9,13H,3H2,1-2H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | ODWLLYWCIPELLC-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|