C19H20N2O4S — CID 87012075
2-cyano-N-(3,4-dimethoxyphenyl)-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxopropanamide (PubChem CID 87012075) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-cyano-N-(3,4-dimethoxyphenyl)-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxopropanamide.
| Compound Name | 2-cyano-N-(3,4-dimethoxyphenyl)-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 87012075 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-cyano-N-(3,4-dimethoxyphenyl)-3-(5-ethyl-4-methylthiophen-2-yl)-3-oxopropanamide |
| SMILES | CCc1sc(C(=O)C(C#N)C(=O)Nc2ccc(OC)c(OC)c2)cc1C |
| InChI | InChI=1S/C19H20N2O4S/c1-5-16-11(2)8-17(26-16)18(22)13(10-20)19(23)21-12-6-7-14(24-3)15(9-12)25-4/h6-9,13H,5H2,1-4H3,(H,21,23) |
| InChIKey | ZYWOCYCFANNYKO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|