About CID 98454356
CID 98454356 (PubChem CID 98454356) has the molecular formula C29H22Cl3N3O3
and a molecular weight of 566.87 g/mol.
Molecular Properties
| Compound Name | CID 98454356 |
| PubChem CID | 98454356 |
| Molecular Formula | C29H22Cl3N3O3 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | — |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)[C@@]21N2CCC[C@@H]2[C@@H](C(=O)c2ccc(Cl)cc2Cl)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H22Cl3N3O3/c1-14-19(31)11-10-18-24(14)34-27(38)29(18)28(17-5-2-3-6-21(17)33-26(28)37)23(22-7-4-12-35(22)29)25(36)16-9-8-15(30)13-20(16)32/h2-3,5-6,8-11,13,22-23H,4,7,12H2,1H3,(H,33,37)(H,34,38)/t22-,23+,28+,29+/m1/s1 |
| InChIKey | VUIKFZDLADUMFA-WGTZDZHJSA-N |
| XLogP | 5.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 98454356 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 98454356?
The IUPAC name of CID 98454356 (CID 98454356) is not available.
What is the SMILES notation for CID 98454356?
The canonical SMILES for CID 98454356 is Cc1c(Cl)ccc2c1NC(=O)[C@@]21N2CCC[C@@H]2[C@@H](C(=O)c2ccc(Cl)cc2Cl)[C@@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 98454356?
The InChIKey is VUIKFZDLADUMFA-WGTZDZHJSA-N. The full InChI is InChI=1S/C29H22Cl3N3O3/c1-14-19(31)11-10-18-24(14)34-27(38)29(18)28(17-5-2-3-6-21(17)33-26(28)37)23(22-7-4-12-35(22)29)25(36)16-9-8-15(30)13-20(16)32/h2-3,5-6,8-11,13,22-23H,4,7,12H2,1H3,(H,33,37)(H,34,38)/t22-,23+,28+,29+/m1/s1.
What are the key properties of CID 98454356?
CID 98454356 has a molecular weight of 566.87 g/mol, XLogP of 5.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 98454356 is sourced from PubChem (CID 98454356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).