C31H20Cl2N2O3S — CID 98454605
(2'S,3S,3'R,10'bR)-2'-(2,4-dichlorobenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 98454605) has the molecular formula C31H20Cl2N2O3S and a molecular weight of 571.49 g/mol. Its IUPAC name is (2'S,3S,3'R,10'bR)-2'-(2,4-dichlorobenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'S,3S,3'R,10'bR)-2'-(2,4-dichlorobenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 98454605 |
| Molecular Formula | C31H20Cl2N2O3S |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | (2'S,3S,3'R,10'bR)-2'-(2,4-dichlorobenzoyl)-3'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | O=C(c1ccc(Cl)cc1Cl)[C@@H]1[C@H](C(=O)c2cccs2)N2C=Cc3ccccc3[C@@H]2[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C31H20Cl2N2O3S/c32-18-11-12-20(22(33)16-18)27(36)25-26(28(37)24-10-5-15-39-24)35-14-13-17-6-1-2-7-19(17)29(35)31(25)21-8-3-4-9-23(21)34-30(31)38/h1-16,25-26,29H,(H,34,38)/t25-,26+,29+,31+/m0/s1 |
| InChIKey | NCSFRJNDYYGCDW-QSNJERLUSA-N |
| XLogP | 7.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |