C17H24ClNO2 — CID 98455193
(3S)-1-[(3R,5R)-3,5-dimethyl-1-adamantyl]-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 98455193) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is (3S)-1-[(3R,5R)-3,5-dimethyl-1-adamantyl]-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | (3S)-1-[(3R,5R)-3,5-dimethyl-1-adamantyl]-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 98455193 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3S)-1-[(3R,5R)-3,5-dimethyl-1-adamantyl]-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | C[C@]12CC3CC(N4C[C@@H](C(=O)Cl)CC4=O)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C17H24ClNO2/c1-15-4-11-5-16(2,8-15)10-17(6-11,9-15)19-7-12(14(18)21)3-13(19)20/h11-12H,3-10H2,1-2H3/t11?,12-,15+,16+,17?/m0/s1 |
| InChIKey | UNORUJNFWLFQQA-ZSDCSZLFSA-N |
| XLogP | 3.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|