C21H16N4O3 — CID 98463384
(3R)-1-naphthalen-1-yl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyrrolidine-2,5-dione (PubChem CID 98463384) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is (3R)-1-naphthalen-1-yl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-naphthalen-1-yl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98463384 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (3R)-1-naphthalen-1-yl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](Nc2ccc3[nH]c(=O)[nH]c3c2)C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C21H16N4O3/c26-19-11-17(22-13-8-9-15-16(10-13)24-21(28)23-15)20(27)25(19)18-7-3-5-12-4-1-2-6-14(12)18/h1-10,17,22H,11H2,(H2,23,24,28)/t17-/m1/s1 |
| InChIKey | YFOMEJJODUIDLU-QGZVFWFLSA-N |
| XLogP | 2.75 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|