C24H20ClN3O2 — CID 4874274
3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-naphthalen-1-ylpyrrolidine-2,5-dione (PubChem CID 4874274) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-naphthalen-1-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-naphthalen-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4874274 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-naphthalen-1-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCc2c[nH]c3ccc(Cl)cc23)C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C24H20ClN3O2/c25-17-8-9-20-19(12-17)16(14-27-20)10-11-26-21-13-23(29)28(24(21)30)22-7-3-5-15-4-1-2-6-18(15)22/h1-9,12,14,21,26-27H,10-11,13H2 |
| InChIKey | RYLDHEMBDUBCAH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|