C20H17ClFN3O2 — CID 7357869
(3R)-1-(3-chloro-4-fluorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione (PubChem CID 7357869) has the molecular formula C20H17ClFN3O2 and a molecular weight of 385.83 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-fluorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3-chloro-4-fluorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7357869 |
| Molecular Formula | C20H17ClFN3O2 |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (3R)-1-(3-chloro-4-fluorophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](NCCc2c[nH]c3ccccc23)C(=O)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H17ClFN3O2/c21-15-9-13(5-6-16(15)22)25-19(26)10-18(20(25)27)23-8-7-12-11-24-17-4-2-1-3-14(12)17/h1-6,9,11,18,23-24H,7-8,10H2/t18-/m1/s1 |
| InChIKey | GQDLBMHBPHUQJG-GOSISDBHSA-N |
| XLogP | 3.42 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|