C21H20ClN3O3 — CID 40520421
(3R)-3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 40520421) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is (3R)-3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 40520421 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (3R)-3-[2-(5-chloro-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C[C@@H](NCCc3c[nH]c4ccc(Cl)cc34)C2=O)c1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-28-16-4-2-3-15(10-16)25-20(26)11-19(21(25)27)23-8-7-13-12-24-18-6-5-14(22)9-17(13)18/h2-6,9-10,12,19,23-24H,7-8,11H2,1H3/t19-/m1/s1 |
| InChIKey | YNKNQSKOUVHNEO-LJQANCHMSA-N |
| XLogP | 3.29 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|