C24H25N3O8 — CID 90485752
3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione;oxalic acid (PubChem CID 90485752) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is 3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione;oxalic acid.
| Compound Name | 3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione;oxalic acid |
|---|---|
| PubChem CID | 90485752 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-1-(3-methoxyphenyl)pyrrolidine-2,5-dione;oxalic acid |
| SMILES | COc1cccc(N2C(=O)CC(NCCc3c[nH]c4ccc(OC)cc34)C2=O)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H23N3O4.C2H2O4/c1-28-16-5-3-4-15(10-16)25-21(26)12-20(22(25)27)23-9-8-14-13-24-19-7-6-17(29-2)11-18(14)19;3-1(4)2(5)6/h3-7,10-11,13,20,23-24H,8-9,12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XEWCUWCUKUSDQA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 158.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|