C21H20N4O4 — CID 124542493
(3R)-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-1-(3-nitrophenyl)pyrrolidine-2,5-dione (PubChem CID 124542493) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is (3R)-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-1-(3-nitrophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-1-(3-nitrophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 124542493 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (3R)-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-1-(3-nitrophenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc2[nH]cc(CCN[C@@H]3CC(=O)N(c4cccc([N+](=O)[O-])c4)C3=O)c2c1 |
| InChI | InChI=1S/C21H20N4O4/c1-13-5-6-18-17(9-13)14(12-23-18)7-8-22-19-11-20(26)24(21(19)27)15-3-2-4-16(10-15)25(28)29/h2-6,9-10,12,19,22-23H,7-8,11H2,1H3/t19-/m1/s1 |
| InChIKey | FOYGEQITFDUTSM-LJQANCHMSA-N |
| XLogP | 2.85 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|