C21H20ClN3O2 — CID 9350243
(3S)-1-(2-chloro-4-methylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione (PubChem CID 9350243) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is (3S)-1-(2-chloro-4-methylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2-chloro-4-methylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 9350243 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (3S)-1-(2-chloro-4-methylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@H](NCCc3c[nH]c4ccccc34)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-13-6-7-19(16(22)10-13)25-20(26)11-18(21(25)27)23-9-8-14-12-24-17-5-3-2-4-15(14)17/h2-7,10,12,18,23-24H,8-9,11H2,1H3/t18-/m0/s1 |
| InChIKey | CNIRXEDNVVXCHY-SFHVURJKSA-N |
| XLogP | 3.59 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|