C21H21ClN3O2+ — CID 9350242
[(3S)-1-(2-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 9350242) has the molecular formula C21H21ClN3O2+ and a molecular weight of 382.87 g/mol. Its IUPAC name is [(3S)-1-(2-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | [(3S)-1-(2-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9350242 |
| Molecular Formula | C21H21ClN3O2+ |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [(3S)-1-(2-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | Cc1ccc(N2C(=O)C[C@H]([NH2+]CCc3c[nH]c4ccccc34)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-13-6-7-19(16(22)10-13)25-20(26)11-18(21(25)27)23-9-8-14-12-24-17-5-3-2-4-15(14)17/h2-7,10,12,18,23-24H,8-9,11H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | CNIRXEDNVVXCHY-SFHVURJKSA-O |
| XLogP | 2.57 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|