C20H18Cl2N3O2+ — CID 7647708
[(3R)-1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 7647708) has the molecular formula C20H18Cl2N3O2+ and a molecular weight of 403.29 g/mol. Its IUPAC name is [(3R)-1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | [(3R)-1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 7647708 |
| Molecular Formula | C20H18Cl2N3O2+ |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [(3R)-1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | O=C1C[C@@H]([NH2+]CCc2c[nH]c3ccccc23)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c21-13-7-14(22)9-15(8-13)25-19(26)10-18(20(25)27)23-6-5-12-11-24-17-4-2-1-3-16(12)17/h1-4,7-9,11,18,23-24H,5-6,10H2/p+1/t18-/m1/s1 |
| InChIKey | CUUXDDIYBCFWPA-GOSISDBHSA-O |
| XLogP | 2.91 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|