C22H22ClN3O3 — CID 4874247
1-(5-chloro-2-methylphenyl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione (PubChem CID 4874247) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4874247 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2[nH]cc(CCNC3CC(=O)N(c4cc(Cl)ccc4C)C3=O)c2c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-13-3-4-15(23)9-20(13)26-21(27)11-19(22(26)28)24-8-7-14-12-25-18-6-5-16(29-2)10-17(14)18/h3-6,9-10,12,19,24-25H,7-8,11H2,1-2H3 |
| InChIKey | ALRLARFVZSBGAT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|