C23H23N3O5 — CID 7335769
(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione (PubChem CID 7335769) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7335769 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2[nH]cc(CCN[C@H]3CC(=O)N(c4ccc5c(c4)OCCO5)C3=O)c2c1 |
| InChI | InChI=1S/C23H23N3O5/c1-29-16-3-4-18-17(11-16)14(13-25-18)6-7-24-19-12-22(27)26(23(19)28)15-2-5-20-21(10-15)31-9-8-30-20/h2-5,10-11,13,19,24-25H,6-9,12H2,1H3/t19-/m0/s1 |
| InChIKey | RYYAKJWQLRWILU-IBGZPJMESA-N |
| XLogP | 2.41 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|