C12H13N3S — CID 98468291
2-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3-thiazol-4-amine (PubChem CID 98468291) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3-thiazol-4-amine.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 98468291 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C12H13N3S/c13-11-8-16-12(14-11)15-6-5-9-3-1-2-4-10(9)7-15/h1-4,8H,5-7,13H2 |
| InChIKey | VEMOJVHWYJZWFV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |