C18H13N5O2 — CID 98470454
(2S)-2-cyano-3-oxo-3-(1-phenylpyrazol-3-yl)-N-pyridin-2-ylpropanamide (PubChem CID 98470454) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is (2S)-2-cyano-3-oxo-3-(1-phenylpyrazol-3-yl)-N-pyridin-2-ylpropanamide.
| Compound Name | (2S)-2-cyano-3-oxo-3-(1-phenylpyrazol-3-yl)-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 98470454 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2S)-2-cyano-3-oxo-3-(1-phenylpyrazol-3-yl)-N-pyridin-2-ylpropanamide |
| SMILES | N#C[C@H](C(=O)Nc1ccccn1)C(=O)c1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H13N5O2/c19-12-14(18(25)21-16-8-4-5-10-20-16)17(24)15-9-11-23(22-15)13-6-2-1-3-7-13/h1-11,14H,(H,20,21,25)/t14-/m0/s1 |
| InChIKey | WLTOXFQLBUUGJS-AWEZNQCLSA-N |
| XLogP | 2.23 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|