C9H11NO5S — CID 98478504
(3aR,4S,7S,7aR)-2-methylsulfonyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98478504) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is (3aR,4S,7S,7aR)-2-methylsulfonyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aR)-2-methylsulfonyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98478504 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (3aR,4S,7S,7aR)-2-methylsulfonyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CS(=O)(=O)N1C(=O)[C@@H]2[C@@H](C1=O)[C@@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C9H11NO5S/c1-16(13,14)10-8(11)6-4-2-3-5(15-4)7(6)9(10)12/h4-7H,2-3H2,1H3/t4-,5-,6-,7-/m0/s1 |
| InChIKey | CYUCLKPVYRQJID-AXMZGBSTSA-N |
| XLogP | -0.89 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|