C14H21NO5S — CID 98526161
(3aR,4S,7S,7aR)-2-(2-butylsulfonylethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98526161) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is (3aR,4S,7S,7aR)-2-(2-butylsulfonylethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aR)-2-(2-butylsulfonylethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98526161 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (3aR,4S,7S,7aR)-2-(2-butylsulfonylethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CCCCS(=O)(=O)CCN1C(=O)[C@@H]2[C@@H](C1=O)[C@@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C14H21NO5S/c1-2-3-7-21(18,19)8-6-15-13(16)11-9-4-5-10(20-9)12(11)14(15)17/h9-12H,2-8H2,1H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | VOYRTJCIEXLCII-BJDJZHNGSA-N |
| XLogP | 0.36 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|