C16H27N2O3+ — CID 24776608
2-[(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl-butyl-dimethylazanium (PubChem CID 24776608) has the molecular formula C16H27N2O3+ and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-[(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl-butyl-dimethylazanium.
| Compound Name | 2-[(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl-butyl-dimethylazanium |
|---|---|
| PubChem CID | 24776608 |
| Molecular Formula | C16H27N2O3+ |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-[(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]ethyl-butyl-dimethylazanium |
| SMILES | CCCC[N+](C)(C)CCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C16H27N2O3/c1-4-5-9-18(2,3)10-8-17-15(19)13-11-6-7-12(21-11)14(13)16(17)20/h11-14H,4-10H2,1-3H3/q+1/t11-,12+,13-,14+ |
| InChIKey | CPVCQFSLPLRGIW-KPWCQOOUSA-N |
| XLogP | 1.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|