C17H22N2O2 — CID 98501469
(1R,2R,4S,5R)-5,7,7-trimethyl-N-phenyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonane-3-carboxamide (PubChem CID 98501469) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (1R,2R,4S,5R)-5,7,7-trimethyl-N-phenyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonane-3-carboxamide.
| Compound Name | (1R,2R,4S,5R)-5,7,7-trimethyl-N-phenyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonane-3-carboxamide |
|---|---|
| PubChem CID | 98501469 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1R,2R,4S,5R)-5,7,7-trimethyl-N-phenyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonane-3-carboxamide |
| SMILES | CC1(C)O[C@]2(C)CC[C@@H]1[C@@H]1[C@@H]2N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c1-16(2)12-9-10-17(3,21-16)14-13(12)19(14)15(20)18-11-7-5-4-6-8-11/h4-8,12-14H,9-10H2,1-3H3,(H,18,20)/t12-,13-,14+,17-,19?/m1/s1 |
| InChIKey | RRJUJZSXBQWVIU-UIDNMGKASA-N |
| XLogP | 3.25 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|