C24H22N2O4S — CID 98518406
N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-ethoxy-5-phenylthiophene-2-carboxamide (PubChem CID 98518406) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-ethoxy-5-phenylthiophene-2-carboxamide.
| Compound Name | N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-ethoxy-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 98518406 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]-3-ethoxy-5-phenylthiophene-2-carboxamide |
| SMILES | CCOc1cc(-c2ccccc2)sc1C(=O)Nc1ccc(C[C@@H]2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-2-30-19-14-20(16-6-4-3-5-7-16)31-22(19)24(29)25-18-10-8-15(9-11-18)12-17-13-21(27)26-23(17)28/h3-11,14,17H,2,12-13H2,1H3,(H,25,29)(H,26,27,28)/t17-/m1/s1 |
| InChIKey | LMVPZPFLBVVRNG-QGZVFWFLSA-N |
| XLogP | 4.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|