C13H13NO6 — CID 98526069
(3aR,4R,7R,7aS)-2-[(3R)-2,6-dioxooxan-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98526069) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-2-[(3R)-2,6-dioxooxan-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aS)-2-[(3R)-2,6-dioxooxan-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98526069 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (3aR,4R,7R,7aS)-2-[(3R)-2,6-dioxooxan-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1CC[C@@H](N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@H]3O2)C(=O)O1 |
| InChI | InChI=1S/C13H13NO6/c15-8-4-1-5(13(18)20-8)14-11(16)9-6-2-3-7(19-6)10(9)12(14)17/h5-7,9-10H,1-4H2/t5-,6-,7-,9-,10+/m1/s1 |
| InChIKey | QYMWCZUEONNQGM-RXMKQEINSA-N |
| XLogP | -0.62 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|