C20H25ClO3 — CID 98530178
2-[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 98530178) has the molecular formula C20H25ClO3 and a molecular weight of 348.87 g/mol. Its IUPAC name is 2-[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | 2-[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 98530178 |
| Molecular Formula | C20H25ClO3 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)OCCC1=CC[C@@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C20H25ClO3/c1-13-10-16(21)6-7-18(13)24-12-19(22)23-9-8-14-4-5-15-11-17(14)20(15,2)3/h4,6-7,10,15,17H,5,8-9,11-12H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | DUFSSFCFZDQJII-WBVHZDCISA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|