C11H15FN2O6S2 — CID 98535121
(2R)-2-amino-4-[(4-fluorosulfonylphenyl)methylsulfamoyl]butanoic acid (PubChem CID 98535121) has the molecular formula C11H15FN2O6S2 and a molecular weight of 354.38 g/mol. Its IUPAC name is (2R)-2-amino-4-[(4-fluorosulfonylphenyl)methylsulfamoyl]butanoic acid.
| Compound Name | (2R)-2-amino-4-[(4-fluorosulfonylphenyl)methylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 98535121 |
| Molecular Formula | C11H15FN2O6S2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (2R)-2-amino-4-[(4-fluorosulfonylphenyl)methylsulfamoyl]butanoic acid |
| SMILES | N[C@H](CCS(=O)(=O)NCc1ccc(S(=O)(=O)F)cc1)C(=O)O |
| InChI | InChI=1S/C11H15FN2O6S2/c12-22(19,20)9-3-1-8(2-4-9)7-14-21(17,18)6-5-10(13)11(15)16/h1-4,10,14H,5-7,13H2,(H,15,16)/t10-/m1/s1 |
| InChIKey | LYGNYXLBCRSFFX-SNVBAGLBSA-N |
| XLogP | -0.43 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |