C10H17N3O4S2 — CID 60910335
4-[(3-aminopropylsulfonylamino)methyl]benzenesulfonamide (PubChem CID 60910335) has the molecular formula C10H17N3O4S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-[(3-aminopropylsulfonylamino)methyl]benzenesulfonamide.
| Compound Name | 4-[(3-aminopropylsulfonylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60910335 |
| Molecular Formula | C10H17N3O4S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[(3-aminopropylsulfonylamino)methyl]benzenesulfonamide |
| SMILES | NCCCS(=O)(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H17N3O4S2/c11-6-1-7-18(14,15)13-8-9-2-4-10(5-3-9)19(12,16)17/h2-5,13H,1,6-8,11H2,(H2,12,16,17) |
| InChIKey | CDAMOZGCTFNJJA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |