C8H11BrN2O4S2 — CID 83092326
4-[(bromomethylsulfonylamino)methyl]benzenesulfonamide (PubChem CID 83092326) has the molecular formula C8H11BrN2O4S2 and a molecular weight of 343.22 g/mol. Its IUPAC name is 4-[(bromomethylsulfonylamino)methyl]benzenesulfonamide.
| Compound Name | 4-[(bromomethylsulfonylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 83092326 |
| Molecular Formula | C8H11BrN2O4S2 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 4-[(bromomethylsulfonylamino)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNS(=O)(=O)CBr)cc1 |
| InChI | InChI=1S/C8H11BrN2O4S2/c9-6-16(12,13)11-5-7-1-3-8(4-2-7)17(10,14)15/h1-4,11H,5-6H2,(H2,10,14,15) |
| InChIKey | UDVYJMPTJSMGBI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|