C17H22BrNO2 — CID 98542686
(Z)-3-(5-bromo-2-methoxyphenyl)-1-[(2R,4S)-2-ethyl-4-methylpyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 98542686) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is (Z)-3-(5-bromo-2-methoxyphenyl)-1-[(2R,4S)-2-ethyl-4-methylpyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(5-bromo-2-methoxyphenyl)-1-[(2R,4S)-2-ethyl-4-methylpyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 98542686 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (Z)-3-(5-bromo-2-methoxyphenyl)-1-[(2R,4S)-2-ethyl-4-methylpyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | CC[C@@H]1C[C@H](C)CN1C(=O)/C=C\c1cc(Br)ccc1OC |
| InChI | InChI=1S/C17H22BrNO2/c1-4-15-9-12(2)11-19(15)17(20)8-5-13-10-14(18)6-7-16(13)21-3/h5-8,10,12,15H,4,9,11H2,1-3H3/b8-5-/t12-,15+/m0/s1 |
| InChIKey | DCOUPGZGMSDIRM-ZDJYVOAGSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|