C25H18N2O5 — CID 98559645
(3Z)-3-[[(2E,4Z)-5-oxo-2-(2-oxopropylidene)-4-[(Z)-3-phenylprop-2-enylidene]imidazolidin-1-yl]methylidene]chromene-2,4-dione (PubChem CID 98559645) has the molecular formula C25H18N2O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is (3Z)-3-[[(2E,4Z)-5-oxo-2-(2-oxopropylidene)-4-[(Z)-3-phenylprop-2-enylidene]imidazolidin-1-yl]methylidene]chromene-2,4-dione.
| Compound Name | (3Z)-3-[[(2E,4Z)-5-oxo-2-(2-oxopropylidene)-4-[(Z)-3-phenylprop-2-enylidene]imidazolidin-1-yl]methylidene]chromene-2,4-dione |
|---|---|
| PubChem CID | 98559645 |
| Molecular Formula | C25H18N2O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (3Z)-3-[[(2E,4Z)-5-oxo-2-(2-oxopropylidene)-4-[(Z)-3-phenylprop-2-enylidene]imidazolidin-1-yl]methylidene]chromene-2,4-dione |
| SMILES | CC(=O)/C=c1\[nH]/c(=C\C=C/c2ccccc2)c(=O)n1/C=C1\C(=O)Oc2ccccc2C1=O |
| InChI | InChI=1S/C25H18N2O5/c1-16(28)14-22-26-20(12-7-10-17-8-3-2-4-9-17)24(30)27(22)15-19-23(29)18-11-5-6-13-21(18)32-25(19)31/h2-15,26H,1H3/b10-7-,19-15-,20-12-,22-14+ |
| InChIKey | HTZDFEWGQAPOFD-NAZCMORZSA-N |
| XLogP | 1.68 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|