C17H34O2 — CID 98570869
(2R,4S,5R)-5-ethyl-2-octyl-4-propyl-1,3-dioxane (PubChem CID 98570869) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is (2R,4S,5R)-5-ethyl-2-octyl-4-propyl-1,3-dioxane.
| Compound Name | (2R,4S,5R)-5-ethyl-2-octyl-4-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 98570869 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | (2R,4S,5R)-5-ethyl-2-octyl-4-propyl-1,3-dioxane |
| SMILES | CCCCCCCC[C@@H]1OC[C@@H](CC)[C@H](CCC)O1 |
| InChI | InChI=1S/C17H34O2/c1-4-7-8-9-10-11-13-17-18-14-15(6-3)16(19-17)12-5-2/h15-17H,4-14H2,1-3H3/t15-,16+,17-/m1/s1 |
| InChIKey | IUSAOJXZVJPCML-IXDOHACOSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|