C18H25N3O3S — CID 98604606
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetamide (PubChem CID 98604606) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetamide |
|---|---|
| PubChem CID | 98604606 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)CN(C)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H25N3O3S/c1-12-7-6-9-15(13(12)2)19-17(22)11-21(3)18-14-8-4-5-10-16(14)25(23,24)20-18/h4-5,8,10,12-13,15H,6-7,9,11H2,1-3H3,(H,19,22)/t12-,13+,15+/m1/s1 |
| InChIKey | NMNHCVRDQOYUHX-IPYPFGDCSA-N |
| XLogP | 2.01 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |